EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14Cl2N2O2 |
| Net Charge | 0 |
| Average Mass | 349.217 |
| Monoisotopic Mass | 348.04323 |
| SMILES | O=C1CN2CCOC2(c2ccccc2Cl)c2cc(Cl)ccc2N1 |
| InChI | InChI=1S/C17H14Cl2N2O2/c18-11-5-6-15-13(9-11)17(12-3-1-2-4-14(12)19)21(7-8-23-17)10-16(22)20-15/h1-6,9H,7-8,10H2,(H,20,22) |
| InChIKey | ZIXNZOBDFKSQTC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cloxazolam (CHEBI:31426) has role anxiolytic drug (CHEBI:35474) |
| cloxazolam (CHEBI:31426) is a hemiaminal ether (CHEBI:141498) |
| cloxazolam (CHEBI:31426) is a oxazolobenzodiazepine (CHEBI:35502) |
| Synonyms | Source |
|---|---|
| Cloxazolam | ChEMBL |
| cloxazolazepam | DrugCentral |
| Sepazon | ChEMBL |