EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H15ClN2OS |
| Net Charge | 0 |
| Average Mass | 318.829 |
| Monoisotopic Mass | 318.05936 |
| SMILES | CCc1cc2c(s1)N(C)C(=O)CN=C2c1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN2OS/c1-3-10-8-12-15(11-6-4-5-7-13(11)17)18-9-14(20)19(2)16(12)21-10/h4-8H,3,9H2,1-2H3 |
| InChIKey | CHBRHODLKOZEPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clotiazepam (CHEBI:31425) has role anxiolytic drug (CHEBI:35474) |
| Clotiazepam (CHEBI:31425) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Clotiazepam | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Clozan | ChEMBL |
| Rize | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 718 | DrugCentral |
| D01328 | KEGG DRUG |
| HMDB0015512 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:33671-46-4 | KEGG COMPOUND |
| Citations |
|---|