EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18ClN3S |
| Net Charge | 0 |
| Average Mass | 343.883 |
| Monoisotopic Mass | 343.09100 |
| SMILES | CN1CCN(C2=Nc3ccccc3Sc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C18H18ClN3S/c1-21-8-10-22(11-9-21)18-14-12-13(19)6-7-16(14)23-17-5-3-2-4-15(17)20-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | KAAZGXDPUNNEFN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clotiapine (CHEBI:31424) has role antipsychotic agent (CHEBI:35476) |
| Clotiapine (CHEBI:31424) is a dibenzothiazepine (CHEBI:39268) |
| INN | Source |
|---|---|
| clotiapina | WHO MedNet |
| Synonyms | Source |
|---|---|
| clothiapin | DrugCentral |
| clothiapine | ChEMBL |
| clothiapine | DrugCentral |
| Clothiapine | KEGG COMPOUND |
| Clotiapine | KEGG COMPOUND |
| Entumin | ChEMBL |
| Citations |
|---|