EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17ClN2O3S |
| Net Charge | 0 |
| Average Mass | 328.821 |
| Monoisotopic Mass | 328.06484 |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)CN(C1CCCCC1)C2=O |
| InChI | InChI=1S/C14H17ClN2O3S/c15-12-6-9-8-17(10-4-2-1-3-5-10)14(18)11(9)7-13(12)21(16,19)20/h6-7,10H,1-5,8H2,(H2,16,19,20) |
| InChIKey | VPMWFZKOWULPGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clorexolone (CHEBI:31421) has role cardiovascular drug (CHEBI:35554) |
| Clorexolone (CHEBI:31421) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| clorexolona | WHO MedNet |
| Synonyms | Source |
|---|---|
| chlorexolone | DrugCentral |
| clorexolon | DrugCentral |
| Clorexolone | KEGG COMPOUND |