EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7ClN2O4S2 |
| Net Charge | 0 |
| Average Mass | 270.719 |
| Monoisotopic Mass | 269.95358 |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C6H7ClN2O4S2/c7-5-2-1-4(14(8,10)11)3-6(5)15(9,12)13/h1-3H,(H2,8,10,11)(H2,9,12,13) |
| InChIKey | NENBAISIHCWPKP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Clofenamide (CHEBI:31418) has role cardiovascular drug (CHEBI:35554) |
| Clofenamide (CHEBI:31418) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| clofenamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-chloro-m-benzenedisulfonamide | ChEMBL |
| Clofenamide | KEGG COMPOUND |
| clofenamidum | DrugCentral |
| monochlorphenamide | DrugCentral |