EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N2 |
| Net Charge | 0 |
| Average Mass | 368.524 |
| Monoisotopic Mass | 368.22525 |
| SMILES | C(=C/c1ccccc1)\CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H28N2/c1-4-11-23(12-5-1)13-10-18-27-19-21-28(22-20-27)26(24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-17,26H,18-22H2/b13-10+ |
| InChIKey | DERZBLKQOCDDDZ-JLHYYAGUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-allergic agent A drug used to treat allergic reactions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinnarizine (CHEBI:31403) has role anti-allergic agent (CHEBI:50857) |
| cinnarizine (CHEBI:31403) has role antiemetic (CHEBI:50919) |
| cinnarizine (CHEBI:31403) has role calcium channel blocker (CHEBI:38215) |
| cinnarizine (CHEBI:31403) has role geroprotector (CHEBI:176497) |
| cinnarizine (CHEBI:31403) has role H1-receptor antagonist (CHEBI:37955) |
| cinnarizine (CHEBI:31403) has role histamine antagonist (CHEBI:37956) |
| cinnarizine (CHEBI:31403) has role muscarinic antagonist (CHEBI:48876) |
| cinnarizine (CHEBI:31403) is a N-alkylpiperazine (CHEBI:46845) |
| cinnarizine (CHEBI:31403) is a diarylmethane (CHEBI:51614) |
| cinnarizine (CHEBI:31403) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 1-(diphenylmethyl)-4-[(2E)-3-phenylprop-2-en-1-yl]piperazine |
| INNs | Source |
|---|---|
| cinarizina | WHO MedNet |
| cinnarizine | WHO MedNet |
| cinnarizinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-Benzhydryl-4-cinnamylpiperazin | ChemIDplus |
| 1-Cinnamyl-4-(diphenylmethyl)piperazine | ChemIDplus |
| 1-(Diphenylmethyl)-4-(3-phenyl-2-propenyl)piperazine | ChemIDplus |
| Citations |
|---|