EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31402 - cinnamyl acetate
| Formula | C11H12O2 |
| Net Charge | 0 |
| Average Mass | 176.215 |
| Monoisotopic Mass | 176.08373 |
| SMILES | CC(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-8H,9H2,1H3 |
| InChIKey | WJSDHUCWMSHDCR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinnamyl acetate (CHEBI:31402) has functional parent cinnamyl alcohol (CHEBI:17177) |
| cinnamyl acetate (CHEBI:31402) has role fragrance (CHEBI:48318) |
| cinnamyl acetate (CHEBI:31402) has role insecticide (CHEBI:24852) |
| cinnamyl acetate (CHEBI:31402) has role metabolite (CHEBI:25212) |
| cinnamyl acetate (CHEBI:31402) is a acetate ester (CHEBI:47622) |
| IUPAC Name |
|---|
| 3-phenylprop-2-en-1-yl acetate |
| Synonyms | Source |
|---|---|
| 1-acetoxy-3-phenyl-2-propene | ChemIDplus |
| 1-phenyl-3-acetoxyprop-1-ene | ChEBI |
| 3-phenyl-2-propen-1-ol acetate | ChemIDplus |
| 3-phenyl-2-propen-1-yl acetate | NIST Chemistry WebBook |
| 3-Phenyl-2-propenyl acetate | KEGG COMPOUND |
| 3-phenylallyl acetate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cinnamyl acetate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C12299 | KEGG COMPOUND |
| CN101260042 | Patent |
| Citations |
|---|