EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N5O2 |
| Net Charge | 0 |
| Average Mass | 369.469 |
| Monoisotopic Mass | 369.21648 |
| SMILES | O=C1CCc2cc(OCCCCc3nnnn3C3CCCCC3)ccc2N1 |
| InChI | InChI=1S/C20H27N5O2/c26-20-12-9-15-14-17(10-11-18(15)21-20)27-13-5-4-8-19-22-23-24-25(19)16-6-2-1-3-7-16/h10-11,14,16H,1-9,12-13H2,(H,21,26) |
| InChIKey | RRGUKTPIGVIEKM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). |
| Applications: | bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. vasodilator agent A drug used to cause dilation of the blood vessels. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. fibrin modulating drug A drug that affects the function of fibrin in blood coagulation. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilostazol (CHEBI:31401) has role anticoagulant (CHEBI:50249) |
| cilostazol (CHEBI:31401) has role bronchodilator agent (CHEBI:35523) |
| cilostazol (CHEBI:31401) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| cilostazol (CHEBI:31401) has role fibrin modulating drug (CHEBI:48676) |
| cilostazol (CHEBI:31401) has role neuroprotective agent (CHEBI:63726) |
| cilostazol (CHEBI:31401) has role platelet aggregation inhibitor (CHEBI:50427) |
| cilostazol (CHEBI:31401) has role vasodilator agent (CHEBI:35620) |
| cilostazol (CHEBI:31401) is a lactam (CHEBI:24995) |
| cilostazol (CHEBI:31401) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| 6-[4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy]-3,4-dihydroquinolin-2(1H)-one |
| INNs | Source |
|---|---|
| cilostazol | ChemIDplus |
| cilostazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3,4-dihydro-6-(4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy)-2(1H)-quinolinone | ChemIDplus |
| 6-(4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy)-3,4-dihydro-2(1H)-quinolinone | ChemIDplus |
| 6-(4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy)-3,4-dihydrocarbostyril | ChemIDplus |
| 6-[4-(1-Cyclohexyl-1H-tetrazol-5-yl)-butoxy]-3,4-dihydro-1H-quinolin-2-one | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3632017 | Beilstein |
| CAS:73963-72-1 | KEGG DRUG |
| CAS:73963-72-1 | ChemIDplus |
| Citations |
|---|