EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N5O2 |
| Net Charge | 0 |
| Average Mass | 369.469 |
| Monoisotopic Mass | 369.21648 |
| SMILES | O=C1CCc2cc(OCCCCc3nnnn3C3CCCCC3)ccc2N1 |
| InChI | InChI=1S/C20H27N5O2/c26-20-12-9-15-14-17(10-11-18(15)21-20)27-13-5-4-8-19-22-23-24-25(19)16-6-2-1-3-7-16/h10-11,14,16H,1-9,12-13H2,(H,21,26) |
| InChIKey | RRGUKTPIGVIEKM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor An EC 3.1.4.* (phosphoric diester hydrolase) inhibitor which interferes with the action of 3',5'-cyclic-nucleotide phosphodiesterase (EC 3.1.4.17). |
| Applications: | fibrin modulating drug A drug that affects the function of fibrin in blood coagulation. anticoagulant An agent that prevents blood clotting. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. vasodilator agent A drug used to cause dilation of the blood vessels. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilostazol (CHEBI:31401) has role anticoagulant (CHEBI:50249) |
| cilostazol (CHEBI:31401) has role bronchodilator agent (CHEBI:35523) |
| cilostazol (CHEBI:31401) has role EC 3.1.4.17 (3',5'-cyclic-nucleotide phosphodiesterase) inhibitor (CHEBI:50568) |
| cilostazol (CHEBI:31401) has role fibrin modulating drug (CHEBI:48676) |
| cilostazol (CHEBI:31401) has role neuroprotective agent (CHEBI:63726) |
| cilostazol (CHEBI:31401) has role platelet aggregation inhibitor (CHEBI:50427) |
| cilostazol (CHEBI:31401) has role vasodilator agent (CHEBI:35620) |
| cilostazol (CHEBI:31401) is a lactam (CHEBI:24995) |
| cilostazol (CHEBI:31401) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| 6-[4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy]-3,4-dihydroquinolin-2(1H)-one |
| INNs | Source |
|---|---|
| cilostazol | ChemIDplus |
| cilostazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-[4-(1-Cyclohexyl-1H-tetrazol-5-yl)-butoxy]-3,4-dihydro-1H-quinolin-2-one | ChEMBL |
| 6-(4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy)-3,4-dihydro-2(1H)-quinolinone | ChemIDplus |
| 6-(4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy)-3,4-dihydrocarbostyril | ChemIDplus |
| 3,4-dihydro-6-(4-(1-cyclohexyl-1H-tetrazol-5-yl)butoxy)-2(1H)-quinolinone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3632017 | Beilstein |
| CAS:73963-72-1 | ChemIDplus |
| CAS:73963-72-1 | KEGG DRUG |
| Citations |
|---|