EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28N2O7 |
| Net Charge | 0 |
| Average Mass | 492.528 |
| Monoisotopic Mass | 492.18965 |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OC/C=C/c2ccccc2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H28N2O7/c1-18-23(26(30)35-14-8-11-20-9-5-4-6-10-20)25(21-12-7-13-22(17-21)29(32)33)24(19(2)28-18)27(31)36-16-15-34-3/h4-13,17,25,28H,14-16H2,1-3H3/b11-8+ |
| InChIKey | KJEBULYHNRNJTE-DHZHZOJOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilnidipine (CHEBI:31399) has role antihypertensive agent (CHEBI:35674) |
| cilnidipine (CHEBI:31399) has role calcium channel blocker (CHEBI:38215) |
| cilnidipine (CHEBI:31399) has role cardiovascular drug (CHEBI:35554) |
| cilnidipine (CHEBI:31399) is a C-nitro compound (CHEBI:35716) |
| cilnidipine (CHEBI:31399) is a 2-methoxyethyl ester (CHEBI:136838) |
| cilnidipine (CHEBI:31399) is a dihydropyridine (CHEBI:50075) |
| IUPAC Name |
|---|
| 2-methoxyethyl (2E)-3-phenylprop-2-en-1-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| INN | Source |
|---|---|
| cilnidipine | ChemIDplus |
| Synonym | Source |
|---|---|
| (±)-(E)-cinnamyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-(m-nitrophenyl)-3,5-pyridinedicarboxylate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 642 | DrugCentral |
| Cilnidipine | Wikipedia |
| D01173 | KEGG DRUG |
| EP161877 | Patent |
| US4672068 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:132203-70-4 | ChemIDplus |