EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44O7 |
| Net Charge | 0 |
| Average Mass | 540.697 |
| Monoisotopic Mass | 540.30870 |
| SMILES | [H][C@@]12C[C@@]3([H])O[C@@H](C4CCCCC4)O[C@@]3(C(=O)COC(=O)C(C)C)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C32H44O7/c1-18(2)28(36)37-17-25(35)32-26(38-29(39-32)19-8-6-5-7-9-19)15-23-22-11-10-20-14-21(33)12-13-30(20,3)27(22)24(34)16-31(23,32)4/h12-14,18-19,22-24,26-27,29,34H,5-11,15-17H2,1-4H3/t22-,23-,24-,26+,27+,29+,30-,31-,32+/m0/s1 |
| InChIKey | LUKZNWIVRBCLON-GXOBDPJESA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-asthmatic agent Any compound that has anti-asthmatic effects. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ciclesonide (CHEBI:31397) has role anti-allergic agent (CHEBI:50857) |
| Ciclesonide (CHEBI:31397) has role anti-asthmatic agent (CHEBI:65023) |
| Ciclesonide (CHEBI:31397) has role antiviral agent (CHEBI:22587) |
| Ciclesonide (CHEBI:31397) has role nasal decongestant (CHEBI:77715) |
| Ciclesonide (CHEBI:31397) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| ciclesonida | WHO MedNet |
| Synonyms | Source |
|---|---|
| alvesco | DrugCentral |
| BI54903 | ChEMBL |
| Ciclesonide | KEGG COMPOUND |
| omnaris | DrugCentral |
| RPR-251526 | ChEMBL |
| RPR251526 | ChEMBL |
| Brand Names | Source |
|---|---|
| Alvesco 160 | ChEMBL |
| Alvesco 80 | ChEMBL |
| Aservo equihaler | ChEMBL |
| Zetonna | ChEMBL |
| Citations |
|---|