EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31381 - Cefteram pivoxil
| Formula | C22H27N9O7S2 |
| Net Charge | 0 |
| Average Mass | 593.648 |
| Monoisotopic Mass | 593.14749 |
| SMILES | [H][C@]12SCC(Cn3nnc(C)n3)=C(C(=O)OCOC(=O)C(C)(C)C)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C22H27N9O7S2/c1-10-26-29-30(27-10)6-11-7-39-18-14(25-16(32)13(28-36-5)12-8-40-21(23)24-12)17(33)31(18)15(11)19(34)37-9-38-20(35)22(2,3)4/h8,14,18H,6-7,9H2,1-5H3,(H2,23,24)(H,25,32)/b28-13-/t14-,18-/m1/s1 |
| InChIKey | UIYAXIPXULMHAI-JLGRZTKVSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cefteram pivoxil (CHEBI:31381) is a 1,3-thiazoles (CHEBI:38418) |
| Cefteram pivoxil (CHEBI:31381) is a cephams (CHEBI:35995) |
| Cefteram pivoxil (CHEBI:31381) is a oxime O-ether (CHEBI:36816) |
| Cefteram pivoxil (CHEBI:31381) is a pivaloyloxymethyl ester (CHEBI:136685) |
| Cefteram pivoxil (CHEBI:31381) is a tetrazoles (CHEBI:35689) |
| Synonyms | Source |
|---|---|
| Cefteram pivoxil | KEGG COMPOUND |
| T 2588 | KEGG COMPOUND |
| Tomiron (TN) | KEGG COMPOUND |
| tomiron | DrugCentral |