EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5S |
| Net Charge | 0 |
| Average Mass | 365.411 |
| Monoisotopic Mass | 365.10454 |
| SMILES | [H][C@]12SCC(OC)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)C1=CCC=CC1 |
| InChI | InChI=1S/C16H19N3O5S/c1-24-9-7-25-15-11(14(21)19(15)12(9)16(22)23)18-13(20)10(17)8-5-3-2-4-6-8/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
| InChIKey | RDMOROXKXONCAL-UEKVPHQBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefroxadine (CHEBI:31379) is a cephalosporin (CHEBI:23066) |
| IUPAC Name |
|---|
| 7-{[(2R)-2-amino-2-(cyclohexa-1,4-dien-1-yl)acetyl]amino}-3-methoxy-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefroxadino | ChemIDplus |
| céfroxadine | ChemIDplus |
| cefroxadine | ChemIDplus |
| cefroxadinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (6R,7R)-7-{[(2R)-2-amino-2-(cyclohexa-1,4-dien-1-yl)acetyl]amino}-3-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | IUPAC |
| CXD | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| C12979 | KEGG COMPOUND |
| D01528 | KEGG DRUG |
| 557 | DrugCentral |
| Cefroxadine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8165480 | Reaxys |
| CAS:51762-05-1 | KEGG COMPOUND |
| Citations |
|---|