EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18N6O7S4.2Na |
| Net Charge | 0 |
| Average Mass | 628.647 |
| Monoisotopic Mass | 627.99152 |
| SMILES | [H][C@]12SCC(CSc3nc(C)c(CC(=O)[O-])s3)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1.[Na+].[Na+] |
| InChI | InChI=1S/C20H20N6O7S4.2Na/c1-7-10(3-11(27)28)37-20(22-7)36-5-8-4-34-17-13(16(30)26(17)14(8)18(31)32)24-15(29)12(25-33-2)9-6-35-19(21)23-9;;/h6,13,17H,3-5H2,1-2H3,(H2,21,23)(H,24,29)(H,27,28)(H,31,32);;/q;2*+1/p-2/b25-12-;;/t13-,17-;;/m1../s1 |
| InChIKey | WBOBLQIRACJNPA-AEKYOGSZSA-L |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cefodizime sodium (CHEBI:31372) is a cephalosporin (CHEBI:23066) |
| Synonym | Source |
|---|---|
| Cefodizime sodium | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01863 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:86329-79-5 | KEGG COMPOUND |