EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16FN3O3 |
| Net Charge | 0 |
| Average Mass | 257.265 |
| Monoisotopic Mass | 257.11757 |
| SMILES | CCCCCCNC(=O)n1cc(F)c(=O)nc1=O |
| InChI | InChI=1S/C11H16FN3O3/c1-2-3-4-5-6-13-10(17)15-7-8(12)9(16)14-11(15)18/h7H,2-6H2,1H3,(H,13,17)(H,14,16,18) |
| InChIKey | AOCCBINRVIKJHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carmofur (CHEBI:31360) has role antineoplastic agent (CHEBI:35610) |
| Carmofur (CHEBI:31360) is a organohalogen compound (CHEBI:17792) |
| Carmofur (CHEBI:31360) is a pyrimidines (CHEBI:39447) |
| Synonyms | Source |
|---|---|
| 1-hexylcarbamoyl-5-fluorouracil | DrugCentral |
| Carmofur | KEGG COMPOUND |
| mifurol | DrugCentral |
| NSC-758963 | ChEMBL |
| yamaful | DrugCentral |
| Citations |
|---|