EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O4 |
| Net Charge | 0 |
| Average Mass | 394.511 |
| Monoisotopic Mass | 394.21441 |
| SMILES | COC(=O)/C=C/C(C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C(=O)O |
| InChI | InChI=1S/C25H30O4/c1-20(12-8-14-22(3)16-18-24(26)27)10-6-7-11-21(2)13-9-15-23(4)17-19-25(28)29-5/h6-19H,1-5H3,(H,26,27)/b7-6+,12-8+,13-9+,18-16+,19-17+,20-10+,21-11+,22-14+,23-15- |
| InChIKey | RAFGELQLHMBRHD-SLEZCNMESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Applications: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). anti-inflammatory agent Any compound that has anti-inflammatory effects. food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bixin (CHEBI:3136) has role anti-inflammatory agent (CHEBI:67079) |
| bixin (CHEBI:3136) has role antioxidant (CHEBI:22586) |
| bixin (CHEBI:3136) has role apoptosis inducer (CHEBI:68495) |
| bixin (CHEBI:3136) has role biological pigment (CHEBI:26130) |
| bixin (CHEBI:3136) has role food colouring (CHEBI:77182) |
| bixin (CHEBI:3136) has role insulin-sensitizing drug (CHEBI:50864) |
| bixin (CHEBI:3136) is a carotenoic acid (CHEBI:35311) |
| bixin (CHEBI:3136) is a dicarboxylic acid monoester (CHEBI:36244) |
| bixin (CHEBI:3136) is a methyl ester (CHEBI:25248) |
| Incoming Relation(s) |
| bixin dialdehyde (CHEBI:133327) has functional parent bixin (CHEBI:3136) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
| Synonyms | Source |
|---|---|
| 6'-methyl hydrogen 9'-cis-6,6'-diapocarotene-6,6'-dioate | IUBMB |
| 6'-methyl hydrogen 9'-Z-6,6'-diapocarotene-6,6'-dioate | ChEBI |
| Bixin | KEGG COMPOUND |
| Methyl (9-cis)-hydrogen-6,6'-diapo-psi,psi-carotenedioate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| Bixin | Wikipedia |
| C00003762 | KNApSAcK |
| C08582 | KEGG COMPOUND |
| WO2010149942 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729919 | Reaxys |
| CAS:6983-79-5 | KEGG COMPOUND |
| CAS:6983-79-5 | ChemIDplus |
| Citations |
|---|