EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N3O5 |
| Net Charge | 0 |
| Average Mass | 321.333 |
| Monoisotopic Mass | 321.13247 |
| SMILES | [H]C(COC(N)=O)(OC)C1=C(N2CC2)C(=O)C(C)=C(N2CC2)C1=O |
| InChI | InChI=1S/C15H19N3O5/c1-8-11(17-3-4-17)14(20)10(9(22-2)7-23-15(16)21)12(13(8)19)18-5-6-18/h9H,3-7H2,1-2H3,(H2,16,21) |
| InChIKey | SHHKQEUPHAENFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carboquone (CHEBI:31356) has role antineoplastic agent (CHEBI:35610) |
| Carboquone (CHEBI:31356) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| carbocuona | WHO MedNet |
| Synonyms | Source |
|---|---|
| carbazilquinone | DrugCentral |
| Carboquone | KEGG COMPOUND |
| Esquinon | ChEMBL |
| esquinone | DrugCentral |
| Citations |
|---|