EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O4Pt |
| Net Charge | 0 |
| Average Mass | 371.250 |
| Monoisotopic Mass | 371.04450 |
| SMILES | [H][N]([H])([H])[Pt]1([N]([H])([H])[H])[O]C(=O)C2(CCC2)C(=O)[O]1 |
| InChI | InChI=1S/C6H8O4.2H3N.Pt/c7-4(8)6(5(9)10)2-1-3-6;;;/h1-3H2,(H,7,8)(H,9,10);2*1H3;/q;;;+2/p-2 |
| InChIKey | OLESAACUTLOWQZ-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anticoagulant An agent that prevents blood clotting. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboplatin (CHEBI:31355) has part cyclobutane-1,1-dicarboxylate(2−) (CHEBI:35690) |
| carboplatin (CHEBI:31355) has role analgesic (CHEBI:35480) |
| carboplatin (CHEBI:31355) has role anti-anaemic agent (CHEBI:75835) |
| carboplatin (CHEBI:31355) has role anti-HIV agent (CHEBI:64946) |
| carboplatin (CHEBI:31355) has role anticoagulant (CHEBI:50249) |
| carboplatin (CHEBI:31355) has role antineoplastic agent (CHEBI:35610) |
| carboplatin (CHEBI:31355) has role antiviral agent (CHEBI:22587) |
| carboplatin (CHEBI:31355) has role mutagen (CHEBI:25435) |
| carboplatin (CHEBI:31355) is a platinum coordination entity (CHEBI:33862) |
| IUPAC Name |
|---|
| (SP-4-2)-diammine[cyclobutane-1,1-dicarboxylato(2−)-κ2O,O']platinum |
| INNs | Source |
|---|---|
| carboplatin | WHO MedNet |
| carboplatine | WHO MedNet |
| carboplatino | WHO MedNet |
| carboplatinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Carboplatin | KEGG DRUG |
| cbdca | ChemIDplus |
| cis-(1,1-cyclobutanedicarboxylato)diammineplatinum(II) | ChemIDplus |
| cis-diammine(1,1-cyclobutanedicarboxylato)platinum | ChemIDplus |
| cis-diammine(1,1-cyclobutanedicarboxylato)platinum(II) | ChemIDplus |
| JM-8 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Carboplatin | Wikipedia |
| D01363 | KEGG DRUG |
| DB00958 | DrugBank |
| DE2329485 | Patent |
| HMDB0015093 | HMDB |
| LSM-4265 | LINCS |
| QPT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1044703 | Gmelin |
| Reaxys:11327310 | Reaxys |
| Reaxys:11335262 | Reaxys |
| Reaxys:15523471 | Reaxys |
| Gmelin:51428 | Gmelin |
| CAS:41575-94-4 | ChemIDplus |
| CAS:41575-94-4 | KEGG DRUG |
| Citations |
|---|