EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22FN3O6 |
| Net Charge | 0 |
| Average Mass | 359.354 |
| Monoisotopic Mass | 359.14926 |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C15H22FN3O6/c1-3-4-5-6-24-15(23)18-12-9(16)7-19(14(22)17-12)13-11(21)10(20)8(2)25-13/h7-8,10-11,13,20-21H,3-6H2,1-2H3,(H,17,18,22,23)/t8-,10-,11-,13-/m1/s1 |
| InChIKey | GAGWJHPBXLXJQN-UORFTKCHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capecitabine (CHEBI:31348) has role antimetabolite (CHEBI:35221) |
| capecitabine (CHEBI:31348) has role antineoplastic agent (CHEBI:35610) |
| capecitabine (CHEBI:31348) has role prodrug (CHEBI:50266) |
| capecitabine (CHEBI:31348) is a carbamate ester (CHEBI:23003) |
| capecitabine (CHEBI:31348) is a cytidines (CHEBI:23524) |
| capecitabine (CHEBI:31348) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| 5'-deoxy-5-fluoro-N-[(pentyloxy)carbonyl]cytidine |
| INNs | Source |
|---|---|
| capecitabina | ChEBI |
| capecitabine | KEGG DRUG |
| capécitabine | ChEBI |
| capecitabinum | ChEBI |
| Synonyms | Source |
|---|---|
| (1-(5-Deoxy-beta-D-ribofuranosyl)-5-fluoro-1,2-dihydro-2-oxo-4-pyrimidinyl)-carbamic acid pentyl ester | KEGG COMPOUND |
| Capecitabin | ChEBI |
| pentyl 1-(5-deoxy-β-D-ribofuranosyl)-5-fluoro-1,2-dihydro-2-oxo-4-pyrimidinecarbamate | ChemIDplus |
| Pentyl [1-(5-deoxy-β-D-ribofuranosyl)-5-fluoro-2-oxo-1,2-dihydropyrimidin-4-yl]carbamate | IUPAC |
| Brand Name | Source |
|---|---|
| Xeloda | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 480 | DrugCentral |
| C12650 | KEGG COMPOUND |
| Capecitabine | Wikipedia |
| D01223 | KEGG DRUG |
| DB01101 | DrugBank |
| HMDB0015233 | HMDB |
| LSM-5705 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8583270 | Reaxys |
| CAS:154361-50-9 | KEGG COMPOUND |
| CAS:154361-50-9 | ChemIDplus |