EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N4O5.CH4O3S |
| Net Charge | 0 |
| Average Mass | 494.526 |
| Monoisotopic Mass | 494.14713 |
| SMILES | CN(C)C(=O)COC(=O)Cc1ccc(OC(=O)c2ccc(NC(=N)N)cc2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C20H22N4O5.CH4O3S/c1-24(2)17(25)12-28-18(26)11-13-3-9-16(10-4-13)29-19(27)14-5-7-15(8-6-14)23-20(21)22;1-5(2,3)4/h3-10H,11-12H2,1-2H3,(H4,21,22,23);1H3,(H,2,3,4) |
| InChIKey | FSEKIHNIDBATFG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. antiviral agent A substance that destroys or inhibits replication of viruses. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrinolytic drug A drug that prevent fibrinolysis or lysis of a blood clot or thrombus. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| camostat mesylate (CHEBI:31347) has part camostat(1+) (CHEBI:169939) |
| camostat mesylate (CHEBI:31347) has role anti-inflammatory agent (CHEBI:67079) |
| camostat mesylate (CHEBI:31347) has role anticoronaviral agent (CHEBI:149553) |
| camostat mesylate (CHEBI:31347) has role antifibrinolytic drug (CHEBI:48675) |
| camostat mesylate (CHEBI:31347) has role antihypertensive agent (CHEBI:35674) |
| camostat mesylate (CHEBI:31347) has role antineoplastic agent (CHEBI:35610) |
| camostat mesylate (CHEBI:31347) has role antiviral agent (CHEBI:22587) |
| camostat mesylate (CHEBI:31347) has role serine protease inhibitor (CHEBI:64926) |
| camostat mesylate (CHEBI:31347) is a methanesulfonate salt (CHEBI:38037) |
| IUPAC Name |
|---|
| 4-{2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl}phenyl 4-carbamimidamidobenzoate methanesulfonate |
| Synonyms | Source |
|---|---|
| camostat monomethanesulfonate | ChemIDplus |
| camostat mesilate | ChemIDplus |
| camostat methanesulfonate | ChEBI |
| N,N-dimethylcarbamoylmethyl 4-(4-guanidinobenzoyloxy)phenylacetate methanesulfate | ChemIDplus |
| amino{4-[(4-{2-[2-(dimethylamino)-2-oxoethoxy]-2-oxoethyl}phenoxy)carbonyl]anilino}methaniminium methanesulfonate | IUPAC |
| Brand Names | Source |
|---|---|
| Foipan | ChemIDplus |
| FOY-305 | ChEBI |
| FOY 305 | ChemIDplus |
| FOY305 | ChEBI |
| Foistar | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01766 | KEGG DRUG |
| DBSALT002914 | DrugBank |
| 39251 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:59721-29-8 | ChemIDplus |
| Citations |
|---|