EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C9H16NO5.Ca |
| Net Charge | 0 |
| Average Mass | 476.536 |
| Monoisotopic Mass | 476.16829 |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)[O-].CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C9H17NO5.Ca/c2*1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h2*7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);/q;;+2/p-2/t2*7-;/m00./s1 |
| InChIKey | FAPWYRCQGJNNSJ-UBKPKTQASA-L |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calcium pantothenate (CHEBI:31345) has role anti-ulcer drug (CHEBI:49201) |
| Calcium pantothenate (CHEBI:31345) is a polymer (CHEBI:60027) |
| INNs | Source |
|---|---|
| pantotenato de calcio | WHO MedNet |
| pantothenate de calcium | WHO MedNet |
| Synonyms | Source |
|---|---|
| Calcium pantotenate | ChEMBL |
| Calcium pantothenate | KEGG COMPOUND |
| Calcium pantothenate, d- | ChEMBL |
| D-calcium pantothenate | ChEMBL |
| D-ca pantothenate | ChEMBL |
| NSC-36292 | ChEMBL |
| Brand Names | Source |
|---|---|
| Calpan | ChEMBL |
| Pantholin | ChEMBL |
| Citations |
|---|