EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N5O3 |
| Net Charge | 0 |
| Average Mass | 283.332 |
| Monoisotopic Mass | 283.16444 |
| SMILES | CCOC(=O)NNc1ccc(N(CC)CC(C)O)nn1 |
| InChI | InChI=1S/C12H21N5O3/c1-4-17(8-9(3)18)11-7-6-10(13-15-11)14-16-12(19)20-5-2/h6-7,9,18H,4-5,8H2,1-3H3,(H,13,14)(H,16,19) |
| InChIKey | QLTVVOATEHFXLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cadralazine (CHEBI:31331) has role antihypertensive agent (CHEBI:35674) |
| Cadralazine (CHEBI:31331) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| cadralazina | WHO MedNet |
| Synonyms | Source |
|---|---|
| cadral | DrugCentral |
| Cadralazine | KEGG COMPOUND |
| cadraten | DrugCentral |
| cadrilan | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 461 | DrugCentral |
| D01804 | KEGG DRUG |
| HMDB0041845 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:64241-34-5 | KEGG COMPOUND |
| Citations |
|---|