EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C28H38NO4 |
| Net Charge | 0 |
| Average Mass | 532.519 |
| Monoisotopic Mass | 531.19842 |
| SMILES | CCCCOc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2C[C@@H](OC(=O)[C@H](CO)c2ccccc2)C3)cc1.[Br-] |
| InChI | InChI=1S/C28H38NO4.BrH/c1-3-4-16-32-25-14-10-21(11-15-25)19-29(2)23-12-13-24(29)18-26(17-23)33-28(31)27(20-30)22-8-6-5-7-9-22;/h5-11,14-15,23-24,26-27,30H,3-4,12-13,16-20H2,1-2H3;1H/q+1;/p-1/t23-,24+,26+,27-,29?;/m1./s1 |
| InChIKey | JABDOYKGZCPHPX-XSCYYCMVSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butropium bromide (CHEBI:31327) has part butropium (CHEBI:145697) |
| butropium bromide (CHEBI:31327) has role antispasmodic drug (CHEBI:53784) |
| butropium bromide (CHEBI:31327) has role muscarinic antagonist (CHEBI:48876) |
| butropium bromide (CHEBI:31327) is a organic bromide salt (CHEBI:48369) |
| butropium bromide (CHEBI:31327) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (3-endo)-8-(4-butoxybenzyl)-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| bromure de butropium | WHO MedNet |
| bromuro de butropio | WHO MedNet |
| butropii bromidum | WHO MedNet |
| butropium bromide | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,3r,5S)-8-[(4-butoxyphenyl)methyl]-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azabicyclo[3.2.1]octan-8-ium bromide | IUPAC |
| butropium Br | ChEBI |
| p-butoxybenzyl hyoscyaminium bromide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Coliopan | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:29025-14-7 | ChemIDplus |
| Citations |
|---|