EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Br.C28H38NO4 |
| Net Charge | 0 |
| Average Mass | 532.519 |
| Monoisotopic Mass | 531.19842 |
| SMILES | CCCCOc1ccc(C[N+]2(C)[C@@H]3CC[C@H]2C[C@@H](OC(=O)[C@H](CO)c2ccccc2)C3)cc1.[Br-] |
| InChI | InChI=1S/C28H38NO4.BrH/c1-3-4-16-32-25-14-10-21(11-15-25)19-29(2)23-12-13-24(29)18-26(17-23)33-28(31)27(20-30)22-8-6-5-7-9-22;/h5-11,14-15,23-24,26-27,30H,3-4,12-13,16-20H2,1-2H3;1H/q+1;/p-1/t23-,24+,26+,27-,29?;/m1./s1 |
| InChIKey | JABDOYKGZCPHPX-XSCYYCMVSA-M |
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butropium bromide (CHEBI:31327) has part butropium (CHEBI:145697) |
| butropium bromide (CHEBI:31327) has role antispasmodic drug (CHEBI:53784) |
| butropium bromide (CHEBI:31327) has role muscarinic antagonist (CHEBI:48876) |
| butropium bromide (CHEBI:31327) is a organic bromide salt (CHEBI:48369) |
| butropium bromide (CHEBI:31327) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| (3-endo)-8-(4-butoxybenzyl)-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| INNs | Source |
|---|---|
| bromure de butropium | WHO MedNet |
| bromuro de butropio | WHO MedNet |
| butropii bromidum | WHO MedNet |
| butropium bromide | WHO MedNet |
| Synonyms | Source |
|---|---|
| (1R,3r,5S)-8-[(4-butoxyphenyl)methyl]-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azabicyclo[3.2.1]octan-8-ium bromide | IUPAC |
| butropium Br | ChEBI |
| p-butoxybenzyl hyoscyaminium bromide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Coliopan | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:29025-14-7 | ChemIDplus |
| Citations |
|---|