EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N.HCl |
| Net Charge | 0 |
| Average Mass | 353.937 |
| Monoisotopic Mass | 353.19103 |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C23H27N.ClH/c1-23(2,3)21-14-12-18(13-15-21)16-24(4)17-20-10-7-9-19-8-5-6-11-22(19)20;/h5-15H,16-17H2,1-4H3;1H |
| InChIKey | LJBSAUIFGPSHCN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butenafine hydrochloride (CHEBI:31325) has part butenafine (CHEBI:3238) |
| butenafine hydrochloride (CHEBI:31325) has role antifungal drug (CHEBI:86327) |
| butenafine hydrochloride (CHEBI:31325) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| butenafine hydrochloride (CHEBI:31325) is a ammonium salt (CHEBI:47704) |
| butenafine hydrochloride (CHEBI:31325) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 4-tert-butylbenzyl(methyl)(1-naphthalenemethyl)amine hydrochloride | ChEBI |
| (4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanaminium chloride | IUPAC |
| butenafine HCl | ChemIDplus |
| Butenafine hydrochloride | KEGG COMPOUND |
| N-(p-tert-butylbenzyl)-N-methyl-1-naphthalenemethylamine hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:101827-46-7 | KEGG COMPOUND |
| CAS:101827-46-7 | ChemIDplus |