EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27N.HCl |
| Net Charge | 0 |
| Average Mass | 353.937 |
| Monoisotopic Mass | 353.19103 |
| SMILES | CN(Cc1ccc(C(C)(C)C)cc1)Cc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C23H27N.ClH/c1-23(2,3)21-14-12-18(13-15-21)16-24(4)17-20-10-7-9-19-8-5-6-11-22(19)20;/h5-15H,16-17H2,1-4H3;1H |
| InChIKey | LJBSAUIFGPSHCN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butenafine hydrochloride (CHEBI:31325) has part butenafine (CHEBI:3238) |
| butenafine hydrochloride (CHEBI:31325) has role antifungal drug (CHEBI:86327) |
| butenafine hydrochloride (CHEBI:31325) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| butenafine hydrochloride (CHEBI:31325) is a ammonium salt (CHEBI:47704) |
| butenafine hydrochloride (CHEBI:31325) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanamine hydrochloride |
| Synonyms | Source |
|---|---|
| 4-tert-butylbenzyl(methyl)(1-naphthalenemethyl)amine hydrochloride | ChEBI |
| (4-tert-butylphenyl)-N-methyl-N-(naphthalen-1-ylmethyl)methanaminium chloride | IUPAC |
| butenafine HCl | ChemIDplus |
| Butenafine hydrochloride | KEGG COMPOUND |
| N-(p-tert-butylbenzyl)-N-methyl-1-naphthalenemethylamine hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:101827-46-7 | KEGG COMPOUND |
| CAS:101827-46-7 | ChemIDplus |