EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O4 |
| Net Charge | 0 |
| Average Mass | 384.516 |
| Monoisotopic Mass | 384.23006 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](c5ccc(=O)oc5)C[C@H]5O[C@@]534)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C24H32O4/c1-22-9-7-16(25)11-15(22)4-5-18-17(22)8-10-23(2)19(12-20-24(18,23)28-20)14-3-6-21(26)27-13-14/h3,6,13,15-20,25H,4-5,7-12H2,1-2H3/t15-,16+,17+,18-,19-,20-,22+,23-,24-/m1/s1 |
| InChIKey | ATLJNLYIJOCWJE-CWMZOUAVSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.9 (Na(+)/K(+)-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of Na+/K+-transporting ATPase (EC 3.6.3.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bufogenin (CHEBI:31319) has functional parent bufanolide (CHEBI:22934) |
| bufogenin (CHEBI:31319) has role EC 3.6.3.9 (Na+/K+-transporting ATPase) inhibitor (CHEBI:63510) |
| bufogenin (CHEBI:31319) is a epoxy steroid (CHEBI:145217) |
| bufogenin (CHEBI:31319) is a steroid lactone (CHEBI:26766) |
| IUPAC Name |
|---|
| 3β-hydroxy-5β,15β-14,15-epoxybufa-20,22-dienolide |
| INNs | Source |
|---|---|
| bufogenin | WHO MedNet |
| bufogenina | WHO MedNet |
| bufogénine | WHO MedNet |
| bufogeninum | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bufogein | KEGG COMPOUND |
| Bufogenin | KEGG COMPOUND |
| resibufogenin | DrugCentral |
| respigon | DrugCentral |
| Citations |
|---|