EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31317 - bufexamac
| Formula | C12H17NO3 |
| Net Charge | 0 |
| Average Mass | 223.272 |
| Monoisotopic Mass | 223.12084 |
| SMILES | CCCCOc1ccc(CC(=O)NO)cc1 |
| InChI | InChI=1S/C12H17NO3/c1-2-3-8-16-11-6-4-10(5-7-11)9-12(14)13-15/h4-7,15H,2-3,8-9H2,1H3,(H,13,14) |
| InChIKey | MXJWRABVEGLYDG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bufexamac (CHEBI:31317) has role antipyretic (CHEBI:35493) |
| bufexamac (CHEBI:31317) has role non-narcotic analgesic (CHEBI:35481) |
| bufexamac (CHEBI:31317) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bufexamac (CHEBI:31317) is a aromatic ether (CHEBI:35618) |
| bufexamac (CHEBI:31317) is a hydroxamic acid (CHEBI:24650) |
| IUPAC Name |
|---|
| 2-(4-butoxyphenyl)-N-hydroxyacetamide |
| INNs | Source |
|---|---|
| bufexamac | KEGG DRUG |
| bufexamaco | ChemIDplus |
| bufexamacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-(p-Butoxyphenyl)-acetohydroxamic acid | ChemIDplus |
| Acide p-butoxyphenylacethydroxamique | ChemIDplus |
| Bufexamic acid | ChemIDplus |
| 4-Butoxyphenylacetohydroxamic acid | ChemIDplus |
| p-Butoxyphenylacetohydroxamic acid | ChemIDplus |
| 4-Butoxy-N-hydroxybenzeneacetamide | ChemIDplus |
| Citations |
|---|