EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6Cl4O2S |
| Net Charge | 0 |
| Average Mass | 356.057 |
| Monoisotopic Mass | 353.88426 |
| SMILES | Oc1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
| InChIKey | JFIOVJDNOJYLKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antiplatyhelmintic drug An agent used to treat cestode, trematode, or other flatworm infestations in man or animals. anthelminthic drug Substance intended to kill parasitic worms (helminths). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. fungicide A substance used to destroy fungal pests. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bithionol (CHEBI:3131) has role anthelminthic drug (CHEBI:35443) |
| bithionol (CHEBI:3131) has role antifungal agrochemical (CHEBI:86328) |
| bithionol (CHEBI:3131) has role antiplatyhelmintic drug (CHEBI:35684) |
| bithionol (CHEBI:3131) is a aryl sulfide (CHEBI:35683) |
| bithionol (CHEBI:3131) is a bridged diphenyl antifungal drug (CHEBI:87110) |
| bithionol (CHEBI:3131) is a bridged diphenyl fungicide (CHEBI:87039) |
| bithionol (CHEBI:3131) is a dichlorobenzene (CHEBI:23697) |
| bithionol (CHEBI:3131) is a organochlorine pesticide (CHEBI:38656) |
| bithionol (CHEBI:3131) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2,2'-sulfanediylbis(4,6-dichlorophenol) |
| Synonyms | Source |
|---|---|
| 2,2'-Dihydroxy-3,3',5,5'-tetrachlorodiphenyl sulfide | ChemIDplus |
| 2,2'-Thiobis(4,6-dichlorophenol) | ChEBI |
| 2-Hydroxy-3,5-dichlorophenyl sulfide | ChemIDplus |
| Bis(3,5-dichloro-2-hydroxyphenyl) sulfide | ChemIDplus |
| Bithin | NIST Chemistry WebBook |
| Bithionol | KEGG COMPOUND |
| Citations |
|---|