EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6Cl4O2S |
| Net Charge | 0 |
| Average Mass | 356.057 |
| Monoisotopic Mass | 353.88426 |
| SMILES | Oc1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H |
| InChIKey | JFIOVJDNOJYLKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. antiplatyhelmintic drug An agent used to treat cestode, trematode, or other flatworm infestations in man or animals. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. fungicide A substance used to destroy fungal pests. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bithionol (CHEBI:3131) has role antifungal agrochemical (CHEBI:86328) |
| bithionol (CHEBI:3131) has role antiplatyhelmintic drug (CHEBI:35684) |
| bithionol (CHEBI:3131) is a aryl sulfide (CHEBI:35683) |
| bithionol (CHEBI:3131) is a bridged diphenyl antifungal drug (CHEBI:87110) |
| bithionol (CHEBI:3131) is a bridged diphenyl fungicide (CHEBI:87039) |
| bithionol (CHEBI:3131) is a dichlorobenzene (CHEBI:23697) |
| bithionol (CHEBI:3131) is a organochlorine pesticide (CHEBI:38656) |
| bithionol (CHEBI:3131) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2,2'-sulfanediylbis(4,6-dichlorophenol) |
| Synonyms | Source |
|---|---|
| Bithionol | KEGG COMPOUND |
| Bithin | NIST Chemistry WebBook |
| 2,2'-Dihydroxy-3,3',5,5'-tetrachlorodiphenyl sulfide | ChemIDplus |
| 2,2'-Thiobis(4,6-dichlorophenol) | ChEBI |
| 2-Hydroxy-3,5-dichlorophenyl sulfide | ChemIDplus |
| Bis(3,5-dichloro-2-hydroxyphenyl) sulfide | ChemIDplus |
| Citations |
|---|