EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23BrFNO2 |
| Net Charge | 0 |
| Average Mass | 420.322 |
| Monoisotopic Mass | 419.08962 |
| SMILES | O=C(CCCN1CCC(O)(c2ccc(Br)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23BrFNO2/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16/h3-10,26H,1-2,11-15H2 |
| InChIKey | RKLNONIVDFXQRX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bromperidol (CHEBI:31305) has role antidepressant (CHEBI:35469) |
| Bromperidol (CHEBI:31305) has role antipsychotic agent (CHEBI:35476) |
| Bromperidol (CHEBI:31305) has role anxiolytic drug (CHEBI:35474) |
| Bromperidol (CHEBI:31305) is a aromatic ketone (CHEBI:76224) |
| Synonyms | Source |
|---|---|
| azurene | DrugCentral |
| bromoperidol | DrugCentral |
| Bromperidol | KEGG COMPOUND |
| bromperidol HCl | DrugCentral |
| bromperidol hydrochloride | DrugCentral |
| impromen | DrugCentral |
| Citations |
|---|