EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10BrN3O |
| Net Charge | 0 |
| Average Mass | 316.158 |
| Monoisotopic Mass | 315.00072 |
| SMILES | O=C1CN=C(c2ccccn2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C14H10BrN3O/c15-9-4-5-11-10(7-9)14(17-8-13(19)18-11)12-3-1-2-6-16-12/h1-7H,8H2,(H,18,19) |
| InChIKey | VMIYHDSEFNYJSL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bromazepam (CHEBI:31302) has role antidepressant (CHEBI:35469) |
| Bromazepam (CHEBI:31302) has role antipsychotic agent (CHEBI:35476) |
| Bromazepam (CHEBI:31302) has role anxiolytic drug (CHEBI:35474) |
| Bromazepam (CHEBI:31302) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Bromazepam | KEGG COMPOUND |
| Bromazepam civ | ChEMBL |
| durazanil | DrugCentral |
| Lectopam (TN) | KEGG COMPOUND |
| Lexatin | ChEMBL |
| Lexotanil | ChEMBL |
| Brand Names | Source |
|---|---|
| Lectopam | ChEMBL |
| Lexotan | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 399 | DrugCentral |
| D01245 | KEGG DRUG |
| HMDB0015511 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1812-30-2 | KEGG COMPOUND |
| Citations |
|---|