EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O2.C19H28O2 |
| Net Charge | 0 |
| Average Mass | 560.819 |
| Monoisotopic Mass | 560.38656 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H].[H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H28O2.C18H24O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18;1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h11,14-17,21H,3-10H2,1-2H3;3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16-,17-,18-,19-;14-,15-,16+,17+,18+/m01/s1 |
| InChIKey | WDPFQABQVGJEBZ-MAKOZQESSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bothermon (CHEBI:31301) has role androgen (CHEBI:50113) |
| Bothermon (CHEBI:31301) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| 13-Methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol | KEGG COMPOUND |
| Bothermon | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01921 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:8055-33-2 | KEGG COMPOUND |