EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19NO6 |
| Net Charge | 0 |
| Average Mass | 417.417 |
| Monoisotopic Mass | 417.12124 |
| SMILES | CC(=O)Oc1ccc(C2(c3ccc(OC(C)=O)cc3)Oc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C24H19NO6/c1-15(26)29-19-11-7-17(8-12-19)24(18-9-13-20(14-10-18)30-16(2)27)23(28)25-21-5-3-4-6-22(21)31-24/h3-14H,1-2H3,(H,25,28) |
| InChIKey | ZCBJDQBSLZREAA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bisoxatin acetate (CHEBI:31294) has role laxative (CHEBI:50503) |
| Bisoxatin acetate (CHEBI:31294) is a organic molecular entity (CHEBI:50860) |
| INNs | Source |
|---|---|
| bisoxatina | WHO MedNet |
| bisoxatine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bisoxatin | ChEMBL |
| Bisoxatin acetate | KEGG COMPOUND |
| exodol | DrugCentral |
| lasotin | DrugCentral |
| laxonalin | DrugCentral |
| WY 8138 | ChEMBL |