EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2BiN3O9 |
| Net Charge | 0 |
| Average Mass | 397.008 |
| Monoisotopic Mass | 396.95950 |
| SMILES | O=[N+]([O-])[O][Bi]([O][N+](=O)[O-])[O][NH+]([O-])O |
| InChI | InChI=1S/Bi.H2NO3.2NO3/c;3*2-1(3)4/h;1-2H;;/q+3;3*-1 |
| InChIKey | HWSISDHAHRVNMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bismuth subnitrate (CHEBI:31293) has role anti-ulcer drug (CHEBI:49201) |
| Bismuth subnitrate (CHEBI:31293) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Bismuth hydroxide nitrate oxide | KEGG COMPOUND |
| Bismuth nitrate, basic | ChEMBL |
| Bismuth subnitrate | KEGG COMPOUND |
| Bismuth subnitrate, heavy | ChEMBL |
| Bismuthum subnitricum | ChEMBL |
| C.i. 77169 | ChEMBL |