EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5BiO6 |
| Net Charge | 0 |
| Average Mass | 394.091 |
| Monoisotopic Mass | 393.98901 |
| SMILES | O=C(O)c1cc(O)c2c(c1)[O][Bi]([OH])[O]2 |
| InChI | InChI=1S/C7H6O5.Bi.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;;/h1-2,8-10H,(H,11,12);;1H2/q;+3;/p-3 |
| InChIKey | JAONZGLTYYUPCT-UHFFFAOYSA-K |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bismuth subgallate (CHEBI:31292) has role astringent (CHEBI:74783) |
| bismuth subgallate (CHEBI:31292) is a bismuth coordination entity (CHEBI:37384) |
| IUPAC Name |
|---|
| 2,7-dihydroxy-1,3,2-benzodioxabismole-5-carboxylic acid |
| Synonyms | Source |
|---|---|
| Wismutgallathydroxid | ChemIDplus |
| gallic acid bismuth basic salt | ChemIDplus |
| basic bismuth 3,4,5-trihydroxybenzoate | ChemIDplus |
| bismuth subgallate | ChemIDplus |
| basisches Wismutgallat | ChemIDplus |
| Dermatol | KEGG DRUG |