EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N4O8 |
| Net Charge | 0 |
| Average Mass | 430.373 |
| Monoisotopic Mass | 430.11246 |
| SMILES | COc1cc(OC)nc(Oc2cccc(Oc3nc(OC)cc(OC)n3)c2C(=O)O)n1 |
| InChI | InChI=1S/C19H18N4O8/c1-26-12-8-13(27-2)21-18(20-12)30-10-6-5-7-11(16(10)17(24)25)31-19-22-14(28-3)9-15(23-19)29-4/h5-9H,1-4H3,(H,24,25) |
| InChIKey | RYVIXQCRCQLFCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bispyribac (CHEBI:3129) has role herbicide (CHEBI:24527) |
| bispyribac (CHEBI:3129) is a aromatic ether (CHEBI:35618) |
| bispyribac (CHEBI:3129) is a benzoic acids (CHEBI:22723) |
| bispyribac (CHEBI:3129) is a monocarboxylic acid (CHEBI:25384) |
| bispyribac (CHEBI:3129) is a pyrimidines (CHEBI:39447) |
| bispyribac (CHEBI:3129) is conjugate acid of bispyribac(1−) (CHEBI:161936) |
| Incoming Relation(s) |
| bispyribac(1−) (CHEBI:161936) is conjugate base of bispyribac (CHEBI:3129) |
| IUPAC Name |
|---|
| 2,6-bis[(4,6-dimethoxypyrimidin-2-yl)oxy]benzoic acid |
| Synonym | Source |
|---|---|
| 2,6-bis(4,6-dimethoxy-2-pyrimidinyloxy)benzoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10915 | KEGG COMPOUND |
| bispyribac | Alan Wood's Pesticides |
| 6QL | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:125401-75-4 | ChemIDplus |
| Citations |
|---|