EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O7 |
| Net Charge | 0 |
| Average Mass | 416.470 |
| Monoisotopic Mass | 416.18350 |
| SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)C[C@@H](C)[C@](C)(O)C2 |
| InChI | InChI=1S/C23H28O7/c1-12-7-13-8-16-20(30-11-29-16)22(28-6)17(13)18-14(10-23(12,2)24)9-15(25-3)19(26-4)21(18)27-5/h8-9,12,24H,7,10-11H2,1-6H3/t12-,23-/m1/s1 |
| InChIKey | ZWRRJEICIPUPHZ-SFDCACGMSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Besigomsin (CHEBI:31272) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| Besigomsin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01752 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:58546-54-6 | KEGG COMPOUND |