EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18NO4.Cl |
| Net Charge | 0 |
| Average Mass | 371.820 |
| Monoisotopic Mass | 371.09244 |
| SMILES | COc1ccc2cc3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[Cl-] |
| InChI | InChI=1S/C20H18NO4.ClH/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;/h3-4,7-10H,5-6,11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VKJGBAJNNALVAV-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Berberine chloride (TN) (CHEBI:31271) has role anti-inflammatory agent (CHEBI:67079) |
| Berberine chloride (TN) (CHEBI:31271) has role hypoglycemic agent (CHEBI:35526) |
| Berberine chloride (TN) (CHEBI:31271) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| berberine chloride | ChEMBL |
| Berberine chloride | KEGG COMPOUND |
| Berberine hydrochloride | ChEMBL |
| Berberinum | ChEMBL |
| GNF-Pf-4545 | ChEMBL |
| NSC-163088 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C12679 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:633-65-8 | KEGG COMPOUND |
| Citations |
|---|