EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42NO2.Cl |
| Net Charge | 0 |
| Average Mass | 448.091 |
| Monoisotopic Mass | 447.29041 |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C27H42NO2.ClH/c1-26(2,3)22-27(4,5)24-13-15-25(16-14-24)30-20-19-29-18-17-28(6,7)21-23-11-9-8-10-12-23;/h8-16H,17-22H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | UREZNYTWGJKWBI-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. antiviral agent A substance that destroys or inhibits replication of viruses. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzethonium chloride (CHEBI:31264) has role antibacterial agent (CHEBI:33282) |
| benzethonium chloride (CHEBI:31264) has role antifungal agent (CHEBI:35718) |
| benzethonium chloride (CHEBI:31264) has role antiseptic drug (CHEBI:48218) |
| benzethonium chloride (CHEBI:31264) has role antiviral agent (CHEBI:22587) |
| benzethonium chloride (CHEBI:31264) has role disinfectant (CHEBI:48219) |
| benzethonium chloride (CHEBI:31264) is a aromatic ether (CHEBI:35618) |
| benzethonium chloride (CHEBI:31264) is a chloride salt (CHEBI:23114) |
| benzethonium chloride (CHEBI:31264) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| N-benzyl-N,N-dimethyl-2-{2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy}ethanaminium chloride |
| INNs | Source |
|---|---|
| benzethonii chloridum | ChemIDplus |
| benzethonium chloride | ChemIDplus |
| chlorure de benzéthonium | WHO MedNet |
| cloruro de benzetonio | ChemIDplus |
| Synonyms | Source |
|---|---|
| {2-[2-(4-diisobutylphenoxy)ethoxy]ethyl}dimethylbenzylammonium chloride | ChemIDplus |
| benzetonium chloride | ChemIDplus |
| benzyldimethyl(2-{2-[4-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy}ethyl)ammonium chloride | ChemIDplus |
| benzyldimethyl(2-{2-[p-(1,1,3,3-tetramethylbutyl)phenoxy]ethoxy}ethyl)ammonium chloride | ChemIDplus |
| benzyldimethyl-p-(1,1,3,3-tetramethylbutyl)phenoxyethoxy-ethylammonium chloride | ChemIDplus |
| BZT | ChemIDplus |
| Brand Names | Source |
|---|---|
| Anti-germ 77 | ChemIDplus |
| Antiseptol | ChemIDplus |
| Banagerm | ChemIDplus |
| Diapp | ChemIDplus |
| Disilyn | ChemIDplus |
| Hyamine | ChemIDplus |
| Citations |
|---|