EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20N2O5 |
| Net Charge | 0 |
| Average Mass | 404.422 |
| Monoisotopic Mass | 404.13722 |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O5/c26-19-12-6-15(7-13-19)14-20(25-21(27)16-4-2-1-3-5-16)22(28)24-18-10-8-17(9-11-18)23(29)30/h1-13,20,26H,14H2,(H,24,28)(H,25,27)(H,29,30)/t20-/m0/s1 |
| InChIKey | SPPTWHFVYKCNNK-FQEVSTJZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. indicator Anything used in a scientific experiment to indicate the presence of a substance or quality, change in a body, etc. diagnostic agent A substance administered to aid diagnosis of a disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bentiromide (CHEBI:31263) has role diagnostic agent (CHEBI:33295) |
| bentiromide (CHEBI:31263) has role indicator (CHEBI:47867) |
| bentiromide (CHEBI:31263) has role reagent (CHEBI:33893) |
| bentiromide (CHEBI:31263) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 4-[(N-benzoyl-L-tyrosyl)amino]benzoic acid |
| INNs | Source |
|---|---|
| bentiromide | ChemIDplus |
| bentiromido | ChemIDplus |
| bentiromidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(N-benzoyl-L-tyrosylamino)benzoic acid | ChEBI |
| benzoyltyrosyl-p-aminobenzoic acid | ChemIDplus |
| BT-PABA | ChEBI |
| BTPABA | DrugBank |
| N-benzoyl-L-tyrosyl-p-aminobenzoate | ChemIDplus |
| N-benzoyl-L-tyrosyl-p-aminobenzoic acid | ChemIDplus |