EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O3 |
| Net Charge | 0 |
| Average Mass | 282.299 |
| Monoisotopic Mass | 282.10044 |
| SMILES | O=C(O)COc1nn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C16H14N2O3/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20) |
| InChIKey | BYFMCKSPFYVMOU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bendazac (CHEBI:31257) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bendazac (CHEBI:31257) has role ophthalmology drug (CHEBI:66981) |
| bendazac (CHEBI:31257) has role radical scavenger (CHEBI:48578) |
| bendazac (CHEBI:31257) is a indazoles (CHEBI:38769) |
| bendazac (CHEBI:31257) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| [(1-benzyl-1H-indazol-3-yl)oxy]acetic acid |
| INNs | Source |
|---|---|
| bendazac | KEGG DRUG |
| bendazac | WHO MedNet |
| bendazaco | ChemIDplus |
| bendazacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| AF 1934 FREE ACID | ChEMBL |
| AF-1934 FREE ACID | ChEMBL |
| AF-1934 LYSINE | ChEMBL |
| AF 1934 [LYSINE] | ChEMBL |
| bendazolic acid | ChEBI |
| BRN 0893958 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Iwazac | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:893958 | Reaxys |
| CAS:20187-55-7 | KEGG DRUG |
| CAS:20187-55-7 | ChemIDplus |
| Citations |
|---|