EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14N2O3 |
| Net Charge | 0 |
| Average Mass | 282.299 |
| Monoisotopic Mass | 282.10044 |
| SMILES | O=C(O)COc1nn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C16H14N2O3/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20) |
| InChIKey | BYFMCKSPFYVMOU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bendazac (CHEBI:31257) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bendazac (CHEBI:31257) has role radical scavenger (CHEBI:48578) |
| bendazac (CHEBI:31257) is a indazoles (CHEBI:38769) |
| bendazac (CHEBI:31257) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| [(1-benzyl-1H-indazol-3-yl)oxy]acetic acid |
| INNs | Source |
|---|---|
| bendazac | KEGG DRUG |
| bendazaco | ChemIDplus |
| bendazacum | ChemIDplus |
| bendazac | WHO MedNet |
| Synonyms | Source |
|---|---|
| BRN 0893958 | ChemIDplus |
| UNII-G4AG71204O | ChemIDplus |
| EINECS 243-569-2 | ChemIDplus |
| bendazolic acid | ChEBI |
| Brand Name | Source |
|---|---|
| Iwazac | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:893958 | Reaxys |
| CAS:20187-55-7 | KEGG DRUG |
| CAS:20187-55-7 | ChemIDplus |
| Citations |
|---|