EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N2O3 |
| Net Charge | 0 |
| Average Mass | 184.195 |
| Monoisotopic Mass | 184.08479 |
| SMILES | CCC1(CC)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C8H12N2O3/c1-3-8(4-2)5(11)9-7(13)10-6(8)12/h3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | FTOAOBMCPZCFFF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5-diethylbarbituric acid (CHEBI:31252) has role drug allergen (CHEBI:88188) |
| 5,5-diethylbarbituric acid (CHEBI:31252) is a barbiturates (CHEBI:22693) |
| IUPAC Name |
|---|
| 5,5-diethylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Synonyms | Source |
|---|---|
| Barbital | KEGG COMPOUND |
| 5,5-diethylbarbituric acid | NIST Chemistry WebBook |
| 2,4,6(1H,3H,5H)-pyrimidinetrione | NIST Chemistry WebBook |
| Veronal | NIST Chemistry WebBook |
| DEBA | ChemIDplus |
| Barbitone | ChemIDplus |
| Citations |
|---|