EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H19NO4 |
| Net Charge | 0 |
| Average Mass | 361.397 |
| Monoisotopic Mass | 361.13141 |
| SMILES | CC(=O)Oc1ccc(C(c2ccc(OC(C)=O)cc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C22H19NO4/c1-15(24)26-19-10-6-17(7-11-19)22(21-5-3-4-14-23-21)18-8-12-20(13-9-18)27-16(2)25/h3-14,22H,1-2H3 |
| InChIKey | KHOITXIGCFIULA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bisacodyl (CHEBI:3125) has role laxative (CHEBI:50503) |
| Bisacodyl (CHEBI:3125) is a diarylmethane (CHEBI:51614) |
| INN | Source |
|---|---|
| bisacodilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| Bisacodyl | KEGG COMPOUND |
| brocalax | DrugCentral |
| dulcolax | DrugCentral |
| DULCOLAX (TN) | KEGG COMPOUND |
| Evac-q-tabs | ChEMBL |
| Modane | ChEMBL |
| Brand Names | Source |
|---|---|
| Biolax | ChEMBL |
| Bisacodyl component of halflytely | ChEMBL |
| Correctol tablets, caplets | ChEMBL |
| Dulcodos | ChEMBL |
| Entrolax | ChEMBL |
| Feen-a-mint tablets | ChEMBL |
| Citations |
|---|