EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27N5O7S |
| Net Charge | 0 |
| Average Mass | 493.542 |
| Monoisotopic Mass | 493.16312 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](NC(=O)[C@H](N)CC(=O)NC)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H27N5O7S/c1-21(2)15(20(32)33)26-18(31)14(19(26)34-21)25-17(30)13(9-4-6-10(27)7-5-9)24-16(29)11(22)8-12(28)23-3/h4-7,11,13-15,19,27H,8,22H2,1-3H3,(H,23,28)(H,24,29)(H,25,30)(H,32,33)/t11-,13-,14-,15+,19-/m1/s1 |
| InChIKey | BHELIUBJHYAEDK-OAIUPTLZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aspoxicillin (CHEBI:31240) has role antibacterial agent (CHEBI:33282) |
| Aspoxicillin (CHEBI:31240) is a peptide (CHEBI:16670) |
| INNs | Source |
|---|---|
| aspoxicilina | WHO MedNet |
| aspoxicilline | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aspoxicillin | KEGG COMPOUND |
| Doyle | ChEMBL |
| Citations |
|---|