EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O4 |
| Net Charge | 0 |
| Average Mass | 395.459 |
| Monoisotopic Mass | 395.18451 |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc4c(c3)CCC(=O)N4)CC2)cc1OC |
| InChI | InChI=1S/C22H25N3O4/c1-28-19-7-3-16(14-20(19)29-2)22(27)25-11-9-24(10-12-25)17-5-6-18-15(13-17)4-8-21(26)23-18/h3,5-7,13-14H,4,8-12H2,1-2H3,(H,23,26) |
| InChIKey | ZVNYJIZDIRKMBF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arkin (TN) (CHEBI:31237) has role anti-HIV agent (CHEBI:64946) |
| Arkin (TN) (CHEBI:31237) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| vesnarinona | WHO MedNet |
| Synonyms | Source |
|---|---|
| Arkin (TN) | KEGG COMPOUND |
| Arkin z | ChEMBL |
| OPC-8212 | DrugCentral |
| pieranometazine | DrugCentral |
| vesnarinone | ChEMBL |
| Vesnarinone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2817 | DrugCentral |
| D01690 | KEGG DRUG |
| HMDB0042059 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:81840-15-5 | KEGG COMPOUND |
| Citations |
|---|