EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31236 - aripiprazole
| Formula | C23H27Cl2N3O2 |
| Net Charge | 0 |
| Average Mass | 448.394 |
| Monoisotopic Mass | 447.14803 |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C23H27Cl2N3O2/c24-19-4-3-5-21(23(19)25)28-13-11-27(12-14-28)10-1-2-15-30-18-8-6-17-7-9-22(29)26-20(17)16-18/h3-6,8,16H,1-2,7,9-15H2,(H,26,29) |
| InChIKey | CEUORZQYGODEFX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. appetite enhancer A drug which increases appetite. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. second generation antipsychotic Antipsychotic drugs which can have different modes of action but which tend to be less likely than first generation antipsychotics to cause extrapyramidal motor control disabilities such as body rigidity or Parkinson's disease-type movements. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aripiprazole (CHEBI:31236) has role antidepressant (CHEBI:35469) |
| aripiprazole (CHEBI:31236) has role anxiolytic drug (CHEBI:35474) |
| aripiprazole (CHEBI:31236) has role appetite enhancer (CHEBI:50779) |
| aripiprazole (CHEBI:31236) has role drug metabolite (CHEBI:49103) |
| aripiprazole (CHEBI:31236) has role H1-receptor antagonist (CHEBI:37955) |
| aripiprazole (CHEBI:31236) has role second generation antipsychotic (CHEBI:65191) |
| aripiprazole (CHEBI:31236) has role serotonergic agonist (CHEBI:35941) |
| aripiprazole (CHEBI:31236) is a N-alkylpiperazine (CHEBI:46845) |
| aripiprazole (CHEBI:31236) is a N-arylpiperazine (CHEBI:46848) |
| aripiprazole (CHEBI:31236) is a aromatic ether (CHEBI:35618) |
| aripiprazole (CHEBI:31236) is a dichlorobenzene (CHEBI:23697) |
| aripiprazole (CHEBI:31236) is a quinolone (CHEBI:23765) |
| aripiprazole (CHEBI:31236) is a δ-lactam (CHEBI:77727) |
| IUPAC Name |
|---|
| 7-{4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy}-3,4-dihydroquinolin-2(1H)-one |
| INNs | Source |
|---|---|
| aripiprazol | WHO MedNet |
| aripiprazole | WHO MedNet |
| aripiprazole | WHO MedNet |
| aripiprazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 7-[4-[4-[2,3-bis(chloranyl)phenyl]piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one | PDBeChem |
| 7-(4-(4-(2,3-dichlorophenyl)-1-piperazinyl)butyloxy)-3,4-dihydro-2(1H)-quinolinone | ChemIDplus |
| 7-{4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy}-1,2,3,4-tetrahydroquinolin-2-one | ChEBI |
| Aripiprex | ChEMBL |
| NSC-759266 | ChEMBL |
| OPC 14597 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Abilify | DrugBank |
| Abilify asimtufii | ChEMBL |
| Abilify Discmelt | ChemIDplus |
| Abilify Maintena | ChemIDplus |
| Abilify maintena kit | ChEMBL |
| Abilify MyCite | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:129722-12-9 | KEGG COMPOUND |
| CAS:129722-12-9 | ChemIDplus |
| Citations |
|---|