EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31235 - Arginine hydrochloride
| Formula | C6H14N4O2.HCl |
| Net Charge | 0 |
| Average Mass | 210.665 |
| Monoisotopic Mass | 210.08835 |
| SMILES | Cl.N=C(N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 |
| InChIKey | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arginine hydrochloride (CHEBI:31235) has role anti-anaemic agent (CHEBI:75835) |
| Arginine hydrochloride (CHEBI:31235) has role antimalarial (CHEBI:38068) |
| Arginine hydrochloride (CHEBI:31235) has role antineoplastic agent (CHEBI:35610) |
| Arginine hydrochloride (CHEBI:31235) has role antiviral agent (CHEBI:22587) |
| Arginine hydrochloride (CHEBI:31235) is a L-α-amino acid (CHEBI:15705) |
| Synonyms | Source |
|---|---|
| Arginine hydrochloride | KEGG COMPOUND |
| L-arginine hcl | ChEMBL |
| L-arginine hydrochloride | ChEMBL |
| NSC-203450 | ChEMBL |
| NSC-7914 | ChEMBL |
| Brand Name | Source |
|---|---|
| R-gene 10 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01126 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1119-34-2 | KEGG COMPOUND |
| Citations |
|---|