EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31235 - Arginine hydrochloride
| Formula | C6H14N4O2.HCl |
| Net Charge | 0 |
| Average Mass | 210.665 |
| Monoisotopic Mass | 210.08835 |
| SMILES | Cl.N=C(N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 |
| InChIKey | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arginine hydrochloride (CHEBI:31235) has role anti-anaemic agent (CHEBI:75835) |
| Arginine hydrochloride (CHEBI:31235) has role antimalarial (CHEBI:38068) |
| Arginine hydrochloride (CHEBI:31235) has role antineoplastic agent (CHEBI:35610) |
| Arginine hydrochloride (CHEBI:31235) has role antiviral agent (CHEBI:22587) |
| Arginine hydrochloride (CHEBI:31235) is a L-α-amino acid (CHEBI:15705) |
| Synonyms | Source |
|---|---|
| Arginine hydrochloride | KEGG COMPOUND |
| L-arginine hcl | ChEMBL |
| L-arginine hydrochloride | ChEMBL |
| NSC-203450 | ChEMBL |
| NSC-7914 | ChEMBL |
| Brand Name | Source |
|---|---|
| R-gene 10 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01126 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1119-34-2 | KEGG COMPOUND |
| Citations |
|---|