EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O2.HCl |
| Net Charge | 0 |
| Average Mass | 210.665 |
| Monoisotopic Mass | 210.08835 |
| SMILES | Cl.N=C(N)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N4O2.ClH/c7-4(5(11)12)2-1-3-10-6(8)9;/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H/t4-;/m0./s1 |
| InChIKey | KWTQSFXGGICVPE-WCCKRBBISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arginine hydrochloride (CHEBI:31235) is a L-α-amino acid (CHEBI:15705) |
| Synonym | Source |
|---|---|
| Arginine hydrochloride | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D01126 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:1119-34-2 | KEGG COMPOUND |