EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30O5 |
| Net Charge | 0 |
| Average Mass | 386.488 |
| Monoisotopic Mass | 386.20932 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)COC(C)=O)[C@@]1(C)CC=C1[C@@]3(C)CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C23H30O5/c1-14(24)28-13-20(26)23(27)11-8-19-17-5-4-15-12-16(25)6-9-21(15,2)18(17)7-10-22(19,23)3/h7,12,17,19,27H,4-6,8-11,13H2,1-3H3/t17-,19+,21+,22+,23+/m1/s1 |
| InChIKey | YUWPMEXLKGOSBF-GACAOOTBSA-N |
| Roles Classification |
|---|
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anecortave acetate (CHEBI:31215) has role antiglaucoma drug (CHEBI:39456) |
| Anecortave acetate (CHEBI:31215) has role ophthalmology drug (CHEBI:66981) |
| Anecortave acetate (CHEBI:31215) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| anecortava | WHO MedNet |
| Synonyms | Source |
|---|---|
| AL 3789 | ChEMBL |
| AL-3789 | ChEMBL |
| AL3789 | ChEMBL |
| AL 4940 | ChEMBL |
| AL-4940 | ChEMBL |
| AL4940 | ChEMBL |
| Citations |
|---|