EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31205 - amlexanox
| Formula | C16H14N2O4 |
| Net Charge | 0 |
| Average Mass | 298.298 |
| Monoisotopic Mass | 298.09536 |
| SMILES | CC(C)c1ccc2oc3nc(N)c(C(=O)O)cc3c(=O)c2c1 |
| InChI | InChI=1S/C16H14N2O4/c1-7(2)8-3-4-12-9(5-8)13(19)10-6-11(16(20)21)14(17)18-15(10)22-12/h3-7H,1-2H3,(H2,17,18)(H,20,21) |
| InChIKey | SGRYPYWGNKJSDL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amlexanox (CHEBI:31205) has role anti-allergic agent (CHEBI:50857) |
| amlexanox (CHEBI:31205) has role anti-ulcer drug (CHEBI:49201) |
| amlexanox (CHEBI:31205) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| amlexanox (CHEBI:31205) is a monocarboxylic acid (CHEBI:25384) |
| amlexanox (CHEBI:31205) is a pyridochromene (CHEBI:53792) |
| IUPAC Name |
|---|
| 2-amino-5-oxo-7-(propan-2-yl)-5H-chromeno[2,3-b]pyridine-3-carboxylic acid |
| INNs | Source |
|---|---|
| amlexanox | KEGG DRUG |
| amlexanoxo | DrugBank |
| amlexanoxum | DrugBank |
| Synonym | Source |
|---|---|
| 2-Amino-7-isopropyl-5-oxo-5H-(1)benzopyrano(2,3-b)pyridine-3-carboxylic acid | ChemIDplus |
| Citations |
|---|