EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClO3 |
| Net Charge | 0 |
| Average Mass | 226.659 |
| Monoisotopic Mass | 226.03967 |
| SMILES | C=CCOc1ccc(CC(=O)O)cc1Cl |
| InChI | InChI=1S/C11H11ClO3/c1-2-5-15-10-4-3-8(6-9(10)12)7-11(13)14/h2-4,6H,1,5,7H2,(H,13,14) |
| InChIKey | ARHWPKZXBHOEEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alclofenac (CHEBI:31183) has role drug allergen (CHEBI:88188) |
| alclofenac (CHEBI:31183) has role non-narcotic analgesic (CHEBI:35481) |
| alclofenac (CHEBI:31183) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| alclofenac (CHEBI:31183) is a aromatic ether (CHEBI:35618) |
| alclofenac (CHEBI:31183) is a monocarboxylic acid (CHEBI:25384) |
| alclofenac (CHEBI:31183) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| [3-chloro-4-(prop-2-en-1-yloxy)phenyl]acetic acid |
| INNs | Source |
|---|---|
| alclofenac | ChemIDplus |
| alclofénac | WHO MedNet |
| alclofenaco | ChemIDplus |
| alclofenacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-Chloro-4-(2-propenyloxy)benzeneacetic acid | ChemIDplus |
| [4-(allyloxy)-3-chlorophenyl]acetic acid | IUPAC |
| (4-Allyloxy-3-chlorphenyl)essigsäure | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 107 | DrugCentral |
| Alclofenac | Wikipedia |
| BE704368 | Patent |
| D01252 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2116510 | Reaxys |
| CAS:22131-79-9 | ChemIDplus |
| CAS:22131-79-9 | KEGG DRUG |
| Citations |
|---|