EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16O8 |
| Net Charge | 0 |
| Average Mass | 396.351 |
| Monoisotopic Mass | 396.08452 |
| SMILES | CCC(=O)CC(=O)c1c(CC(=O)O)cc2c(c1O)C(=O)c1c(O)cccc1C2=O |
| InChI | InChI=1S/C21H16O8/c1-2-10(22)8-14(24)16-9(7-15(25)26)6-12-18(20(16)28)21(29)17-11(19(12)27)4-3-5-13(17)23/h3-6,23,28H,2,7-8H2,1H3,(H,25,26) |
| InChIKey | OSKHFTHBEFJNCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aklanonic acid (CHEBI:31178) is a dihydroxyanthraquinone (CHEBI:37484) |
| aklanonic acid (CHEBI:31178) is a oxo monocarboxylic acid (CHEBI:35871) |
| aklanonic acid (CHEBI:31178) is a polyphenol (CHEBI:26195) |
| aklanonic acid (CHEBI:31178) is conjugate acid of aklanonate (CHEBI:75309) |
| Incoming Relation(s) |
| methyl aklanonate (CHEBI:75311) has functional parent aklanonic acid (CHEBI:31178) |
| aklanonate (CHEBI:75309) is conjugate base of aklanonic acid (CHEBI:31178) |
| IUPAC Name |
|---|
| [4,5-dihydroxy-9,10-dioxo-3-(3-oxopentanoyl)-9,10-dihydroanthracen-2-yl]acetic acid |
| Synonym | Source |
|---|---|
| 9,10-dioxo-9,10-dihydro-4,5-dihydroxy-3-(1-hydroxy-3-oxo-1-pentenyl)-2-anthraceneacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8520433 | Reaxys |
| CAS:91432-47-2 | KEGG COMPOUND |
| CAS:91432-47-2 | ChemIDplus |
| Citations |
|---|