EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H76N2O15 |
| Net Charge | 0 |
| Average Mass | 885.102 |
| Monoisotopic Mass | 884.52457 |
| SMILES | CO[C@@H]1[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@H](C)O3)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)[C@@H](O[C@H]2CC[C@H](N(C)C)[C@H](C)O2)/C=C/C=C/C[C@@H](C)OC(=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C45H76N2O15/c1-25-22-31(20-21-48)41(62-44-39(51)38(47(10)11)40(28(4)58-44)61-37-24-45(7,53)43(52)29(5)57-37)42(54-12)34(59-30(6)49)23-35(50)55-26(2)16-14-13-15-17-33(25)60-36-19-18-32(46(8)9)27(3)56-36/h13-15,17,21,25-29,31-34,36-44,51-53H,16,18-20,22-24H2,1-12H3/b14-13+,17-15+/t25-,26-,27+,28-,29+,31+,32+,33+,34-,36+,37+,38-,39-,40-,41+,42+,43+,44+,45-/m1/s1 |
| InChIKey | ZPCCSZFPOXBNDL-RSMXASMKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| spiramycin II (CHEBI:31168) has role antibacterial drug (CHEBI:36047) |
| spiramycin II (CHEBI:31168) has role antimicrobial agent (CHEBI:33281) |
| spiramycin II (CHEBI:31168) has role bacterial metabolite (CHEBI:76969) |
| spiramycin II (CHEBI:31168) is a acetate ester (CHEBI:47622) |
| spiramycin II (CHEBI:31168) is a aldehyde (CHEBI:17478) |
| spiramycin II (CHEBI:31168) is a disaccharide derivative (CHEBI:63353) |
| spiramycin II (CHEBI:31168) is a ether (CHEBI:25698) |
| spiramycin II (CHEBI:31168) is a macrolide (CHEBI:25106) |
| spiramycin II (CHEBI:31168) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (4R,5S,6S,7R,9R,10R,11E,13E,16R)-6-{[(2S,3R,4R,5S,6R)-5-{[(2S,4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-yl]oxy}-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy}-10-{[(2R,5S,6S)-5-(dimethylamino)-6-methyloxan-2-yl]oxy}-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)-1-oxacyclohexadeca-11,13-dien-4-yl acetate |
| Synonyms | Source |
|---|---|
| Acetylspiramycin | KEGG COMPOUND |
| Acetylspiramycinum | ChemIDplus |
| Foromacidin B | ChemIDplus |
| Foromacidine B | ChemIDplus |
| Spiramycin 2 | ChemIDplus |
| Spiramycin B | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12891 | KEGG COMPOUND |
| D02420 | KEGG DRUG |
| LMPK05000002 | LIPID MAPS |
| WO2011147316 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25081792 | Reaxys |
| CAS:24916-51-6 | ChemIDplus |
| CAS:24916-51-6 | KEGG COMPOUND |
| Citations |
|---|