EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H18ClNO6 |
| Net Charge | 0 |
| Average Mass | 415.829 |
| Monoisotopic Mass | 415.08226 |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCC(=O)O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClNO6/c1-12-16(10-20(26)29-11-19(24)25)17-9-15(28-2)7-8-18(17)23(12)21(27)13-3-5-14(22)6-4-13/h3-9H,10-11H2,1-2H3,(H,24,25) |
| InChIKey | FSQKKOOTNAMONP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acemetacin (CHEBI:31162) has functional parent indometacin (CHEBI:49662) |
| acemetacin (CHEBI:31162) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| acemetacin (CHEBI:31162) has role non-narcotic analgesic (CHEBI:35481) |
| acemetacin (CHEBI:31162) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| acemetacin (CHEBI:31162) has role prodrug (CHEBI:50266) |
| acemetacin (CHEBI:31162) is a N-acylindole (CHEBI:75884) |
| acemetacin (CHEBI:31162) is a carboxylic ester (CHEBI:33308) |
| acemetacin (CHEBI:31162) is a indol-3-yl carboxylic acid (CHEBI:24810) |
| acemetacin (CHEBI:31162) is a monocarboxylic acid (CHEBI:25384) |
| acemetacin (CHEBI:31162) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| {2-[1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetoxy}acetic acid |
| INNs | Source |
|---|---|
| acemetacin | ChemIDplus |
| acemetacina | ChemIDplus |
| acemetacine | ChemIDplus |
| acemetacinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| indometacin carboxymethyl ester | ChEBI |
| indometacin glycolic ester | ChEBI |
| indomethacin carboxymethyl ester | ChEBI |
| indomethacin glycolic ester | ChEBI |
| K 708 | ChemIDplus |
| K-708 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Acemix | ChEBI |
| Emflex | ChEBI |
| Rantudil | ChEBI |
| Solart | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:501672 | Reaxys |
| CAS:53164-05-9 | ChemIDplus |